(S)-(-)-2-bromo-3-methylbutyric acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

(S)-(-)-2-bromo-3-methylbutyric acid
CAS RN:[26782-75-2]
Formula:C5H9BrO2; 181.03 g/mol
InChiKey:UEBARDWJXBGYEJ-BYPYZUCNSA-N
SMILES:CC(C)[C@H](Br)C(O)=O
Molecular structure of (S)-(-)-2-bromo-3-methylbutyric acid
Melting point:42 °C

Isomers

2-(2-bromoethyl)-1,3-dioxolane
Molecular structure of 2-(2-bromoethyl)-1,3-dioxolane
2-(bromomethyl)butanoic acid
Molecular structure of 2-(bromomethyl)butanoic acid
2-bromo-3-methylbutanoic acid
Molecular structure of 2-bromo-3-methylbutanoic acid
(R)-2-bromo-3-methylbutyric acid
Molecular structure of (R)-2-bromo-3-methylbutyric acid
(S)-(-)-2-bromo-3-methylbutyric acid
Molecular structure of (S)-(-)-2-bromo-3-methylbutyric acid
[3-(bromomethyl)oxetan-3-yl]methanol
Molecular structure of [3-(bromomethyl)oxetan-3-yl]methanol
2-bromopentanoic acid
Molecular structure of 2-bromopentanoic acid
5-bromopentanoic acid
Molecular structure of 5-bromopentanoic acid
2-bromopropyl acetate
Molecular structure of 2-bromopropyl acetate
3-bromopropyl acetate
Molecular structure of 3-bromopropyl acetate
ethyl 2-bromopropionate
Molecular structure of ethyl 2-bromopropionate
ethyl 3-bromopropionate
Molecular structure of ethyl 3-bromopropionate
methyl 4-bromobutanoate
Molecular structure of methyl 4-bromobutanoate
methyl 2-bromobutyrate
Molecular structure of methyl 2-bromobutyrate
methyl 2-bromo-2-methylpropanoate
Molecular structure of methyl 2-bromo-2-methylpropanoate
methyl (2S)-3-bromo-2-methylpropanoate
Molecular structure of methyl (2S)-3-bromo-2-methylpropanoate
propyl bromoacetate
Molecular structure of propyl bromoacetate
  ::